C14H15N4+ — CID 166010748
10,13-dimethyl-2,5,7-triaza-10-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),5,8,10,12,14-hexaene (PubChem CID 166010748) has the molecular formula C14H15N4+ and a molecular weight of 239.30 g/mol. Its IUPAC name is 10,13-dimethyl-2,5,7-triaza-10-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),5,8,10,12,14-hexaene.
| Compound Name | 10,13-dimethyl-2,5,7-triaza-10-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),5,8,10,12,14-hexaene |
|---|---|
| PubChem CID | 166010748 |
| Molecular Formula | C14H15N4+ |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 10,13-dimethyl-2,5,7-triaza-10-azoniatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),5,8,10,12,14-hexaene |
| SMILES | Cc1cccc2c1-c1n(cc[n+]1C)C1=NCCN12 |
| InChI | InChI=1S/C14H15N4/c1-10-4-3-5-11-12(10)13-16(2)8-9-18(13)14-15-6-7-17(11)14/h3-5,8-9H,6-7H2,1-2H3/q+1 |
| InChIKey | CZQASAMTIQSKFT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 24.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|