C35H36NO+ — CID 167357590
2-[6-(7-cyclohexyl-2,3-dihydro-1H-inden-4-yl)-3-methyldibenzofuran-4-yl]-1,5-dimethylpyridin-1-ium (PubChem CID 167357590) has the molecular formula C35H36NO+ and a molecular weight of 486.68 g/mol. Its IUPAC name is 2-[6-(7-cyclohexyl-2,3-dihydro-1H-inden-4-yl)-3-methyldibenzofuran-4-yl]-1,5-dimethylpyridin-1-ium.
| Compound Name | 2-[6-(7-cyclohexyl-2,3-dihydro-1H-inden-4-yl)-3-methyldibenzofuran-4-yl]-1,5-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 167357590 |
| Molecular Formula | C35H36NO+ |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | 2-[6-(7-cyclohexyl-2,3-dihydro-1H-inden-4-yl)-3-methyldibenzofuran-4-yl]-1,5-dimethylpyridin-1-ium |
| SMILES | Cc1ccc(-c2c(C)ccc3c2oc2c(-c4ccc(C5CCCCC5)c5c4CCC5)cccc23)[n+](C)c1 |
| InChI | InChI=1S/C35H36NO/c1-22-15-20-32(36(3)21-22)33-23(2)16-17-31-30-14-8-13-29(34(30)37-35(31)33)28-19-18-25(24-9-5-4-6-10-24)26-11-7-12-27(26)28/h8,13-21,24H,4-7,9-12H2,1-3H3/q+1 |
| InChIKey | JYQGBEUBXHARBP-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|