C22H23N2+ — CID 123506806
8-(1,6-dimethylpyridin-1-ium-2-yl)-7,9,9-trimethylindeno[2,1-b]pyridine (PubChem CID 123506806) has the molecular formula C22H23N2+ and a molecular weight of 315.44 g/mol. Its IUPAC name is 8-(1,6-dimethylpyridin-1-ium-2-yl)-7,9,9-trimethylindeno[2,1-b]pyridine.
| Compound Name | 8-(1,6-dimethylpyridin-1-ium-2-yl)-7,9,9-trimethylindeno[2,1-b]pyridine |
|---|---|
| PubChem CID | 123506806 |
| Molecular Formula | C22H23N2+ |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 8-(1,6-dimethylpyridin-1-ium-2-yl)-7,9,9-trimethylindeno[2,1-b]pyridine |
| SMILES | Cc1ccc2c(c1-c1cccc(C)[n+]1C)C(C)(C)c1ncccc1-2 |
| InChI | InChI=1S/C22H23N2/c1-14-11-12-16-17-9-7-13-23-21(17)22(3,4)20(16)19(14)18-10-6-8-15(2)24(18)5/h6-13H,1-5H3/q+1 |
| InChIKey | REHCGWBYIBUJRO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|