C35H32NO2+ — CID 167358172
4-(2,2-dimethylpropyl)-1,5-dimethyl-2-(6-methyl-3,16-dioxahexacyclo[11.11.0.02,10.04,9.015,23.017,22]tetracosa-1(24),2(10),4(9),5,7,11,13,15(23),17,19,21-undecaen-5-yl)pyridin-1-ium (PubChem CID 167358172) has the molecular formula C35H32NO2+ and a molecular weight of 498.65 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-1,5-dimethyl-2-(6-methyl-3,16-dioxahexacyclo[11.11.0.02,10.04,9.015,23.017,22]tetracosa-1(24),2(10),4(9),5,7,11,13,15(23),17,19,21-undecaen-5-yl)pyridin-1-ium.
| Compound Name | 4-(2,2-dimethylpropyl)-1,5-dimethyl-2-(6-methyl-3,16-dioxahexacyclo[11.11.0.02,10.04,9.015,23.017,22]tetracosa-1(24),2(10),4(9),5,7,11,13,15(23),17,19,21-undecaen-5-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 167358172 |
| Molecular Formula | C35H32NO2+ |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-1,5-dimethyl-2-(6-methyl-3,16-dioxahexacyclo[11.11.0.02,10.04,9.015,23.017,22]tetracosa-1(24),2(10),4(9),5,7,11,13,15(23),17,19,21-undecaen-5-yl)pyridin-1-ium |
| SMILES | Cc1c[n+](C)c(-c2c(C)ccc3c2oc2c4cc5c(cc4ccc32)oc2ccccc25)cc1CC(C)(C)C |
| InChI | InChI=1S/C35H32NO2/c1-20-11-13-26-25-14-12-22-16-31-28(24-9-7-8-10-30(24)37-31)17-27(22)33(25)38-34(26)32(20)29-15-23(18-35(3,4)5)21(2)19-36(29)6/h7-17,19H,18H2,1-6H3/q+1 |
| InChIKey | XOMWGCUXKOCYRM-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 30.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|