C26H32GeNO+ — CID 167365044
trimethyl-[1-methyl-6-(3-methyldibenzofuran-4-yl)-4-(2-methylpropyl)pyridin-1-ium-3-yl]germane (PubChem CID 167365044) has the molecular formula C26H32GeNO+ and a molecular weight of 447.16 g/mol. Its IUPAC name is trimethyl-[1-methyl-6-(3-methyldibenzofuran-4-yl)-4-(2-methylpropyl)pyridin-1-ium-3-yl]germane.
| Compound Name | trimethyl-[1-methyl-6-(3-methyldibenzofuran-4-yl)-4-(2-methylpropyl)pyridin-1-ium-3-yl]germane |
|---|---|
| PubChem CID | 167365044 |
| Molecular Formula | C26H32GeNO+ |
| Molecular Weight | 447.16 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | trimethyl-[1-methyl-6-(3-methyldibenzofuran-4-yl)-4-(2-methylpropyl)pyridin-1-ium-3-yl]germane |
| SMILES | Cc1ccc2c(oc3ccccc32)c1-c1cc(CC(C)C)c([Ge](C)(C)C)c[n+]1C |
| InChI | InChI=1S/C26H32GeNO/c1-17(2)14-19-15-23(28(7)16-22(19)27(4,5)6)25-18(3)12-13-21-20-10-8-9-11-24(20)29-26(21)25/h8-13,15-17H,14H2,1-7H3/q+1 |
| InChIKey | HTEXUNIWKBKNGJ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.16 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|