C20H16O — CID 167687602
3,4-dimethyl-7-phenyldibenzofuran (PubChem CID 167687602) has the molecular formula C20H16O and a molecular weight of 272.35 g/mol. Its IUPAC name is 3,4-dimethyl-7-phenyldibenzofuran.
| Compound Name | 3,4-dimethyl-7-phenyldibenzofuran |
|---|---|
| PubChem CID | 167687602 |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3,4-dimethyl-7-phenyldibenzofuran |
| SMILES | Cc1ccc2c(oc3cc(-c4ccccc4)ccc32)c1C |
| InChI | InChI=1S/C20H16O/c1-13-8-10-18-17-11-9-16(15-6-4-3-5-7-15)12-19(17)21-20(18)14(13)2/h3-12H,1-2H3 |
| InChIKey | KVKYXODOMJXRGM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |