C23H24OSi — CID 167688839
[4-(6,7-dimethyldibenzofuran-3-yl)phenyl]-trimethylsilane (PubChem CID 167688839) has the molecular formula C23H24OSi and a molecular weight of 344.53 g/mol. Its IUPAC name is [4-(6,7-dimethyldibenzofuran-3-yl)phenyl]-trimethylsilane.
| Compound Name | [4-(6,7-dimethyldibenzofuran-3-yl)phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 167688839 |
| Molecular Formula | C23H24OSi |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [4-(6,7-dimethyldibenzofuran-3-yl)phenyl]-trimethylsilane |
| SMILES | Cc1ccc2c(oc3cc(-c4ccc([Si](C)(C)C)cc4)ccc32)c1C |
| InChI | InChI=1S/C23H24OSi/c1-15-6-12-21-20-13-9-18(14-22(20)24-23(21)16(15)2)17-7-10-19(11-8-17)25(3,4)5/h6-14H,1-5H3 |
| InChIKey | XRLCCRRKWOOMRP-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|