C28H28O2Si2 — CID 70938426
trimethyl-(19-trimethylsilyl-3,15-dioxahexacyclo[11.11.0.02,10.04,9.014,22.016,21]tetracosa-1(13),2(10),4(9),5,7,11,14(22),16(21),17,19,23-undecaen-7-yl)silane (PubChem CID 70938426) has the molecular formula C28H28O2Si2 and a molecular weight of 452.70 g/mol. Its IUPAC name is trimethyl-(19-trimethylsilyl-3,15-dioxahexacyclo[11.11.0.02,10.04,9.014,22.016,21]tetracosa-1(13),2(10),4(9),5,7,11,14(22),16(21),17,19,23-undecaen-7-yl)silane.
| Compound Name | trimethyl-(19-trimethylsilyl-3,15-dioxahexacyclo[11.11.0.02,10.04,9.014,22.016,21]tetracosa-1(13),2(10),4(9),5,7,11,14(22),16(21),17,19,23-undecaen-7-yl)silane |
|---|---|
| PubChem CID | 70938426 |
| Molecular Formula | C28H28O2Si2 |
| Molecular Weight | 452.70 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | trimethyl-(19-trimethylsilyl-3,15-dioxahexacyclo[11.11.0.02,10.04,9.014,22.016,21]tetracosa-1(13),2(10),4(9),5,7,11,14(22),16(21),17,19,23-undecaen-7-yl)silane |
| SMILES | C[Si](C)(C)c1ccc2oc3c(ccc4c3ccc3c5cc([Si](C)(C)C)ccc5oc34)c2c1 |
| InChI | InChI=1S/C28H28O2Si2/c1-31(2,3)17-7-13-25-23(15-17)21-11-9-20-19(27(21)29-25)10-12-22-24-16-18(32(4,5)6)8-14-26(24)30-28(20)22/h7-16H,1-6H3 |
| InChIKey | YJRVBKDTZGLLDX-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.70 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|