C44H52O2Si2 — CID 70938411
tri(propan-2-yl)-[2-[19-[2-tri(propan-2-yl)silylethynyl]-3,15-dioxahexacyclo[11.11.0.02,10.04,9.014,22.016,21]tetracosa-1(13),2(10),4(9),5,7,11,14(22),16(21),17,19,23-undecaen-7-yl]ethynyl]silane (PubChem CID 70938411) has the molecular formula C44H52O2Si2 and a molecular weight of 669.07 g/mol. Its IUPAC name is tri(propan-2-yl)-[2-[19-[2-tri(propan-2-yl)silylethynyl]-3,15-dioxahexacyclo[11.11.0.02,10.04,9.014,22.016,21]tetracosa-1(13),2(10),4(9),5,7,11,14(22),16(21),17,19,23-undecaen-7-yl]ethynyl]silane.
| Compound Name | tri(propan-2-yl)-[2-[19-[2-tri(propan-2-yl)silylethynyl]-3,15-dioxahexacyclo[11.11.0.02,10.04,9.014,22.016,21]tetracosa-1(13),2(10),4(9),5,7,11,14(22),16(21),17,19,23-undecaen-7-yl]ethynyl]silane |
|---|---|
| PubChem CID | 70938411 |
| Molecular Formula | C44H52O2Si2 |
| Molecular Weight | 669.07 g/mol |
| Exact Mass | 668.35 |
| IUPAC Name | tri(propan-2-yl)-[2-[19-[2-tri(propan-2-yl)silylethynyl]-3,15-dioxahexacyclo[11.11.0.02,10.04,9.014,22.016,21]tetracosa-1(13),2(10),4(9),5,7,11,14(22),16(21),17,19,23-undecaen-7-yl]ethynyl]silane |
| SMILES | CC(C)[Si](C#Cc1ccc2oc3c(ccc4c3ccc3c5cc(C#C[Si](C(C)C)(C(C)C)C(C)C)ccc5oc34)c2c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C44H52O2Si2/c1-27(2)47(28(3)4,29(5)6)23-21-33-13-19-41-39(25-33)37-17-15-36-35(43(37)45-41)16-18-38-40-26-34(14-20-42(40)46-44(36)38)22-24-48(30(7)8,31(9)10)32(11)12/h13-20,25-32H,1-12H3 |
| InChIKey | XFNBLVGKNZYMJT-UHFFFAOYSA-N |
| XLogP | 13.78 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.07 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|