C35H41N2O+ — CID 166038434
4-(4-cyclohexylcyclohexyl)-7-methyl-6-(1-methyl-4-propan-2-ylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile (PubChem CID 166038434) has the molecular formula C35H41N2O+ and a molecular weight of 505.73 g/mol. Its IUPAC name is 4-(4-cyclohexylcyclohexyl)-7-methyl-6-(1-methyl-4-propan-2-ylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile.
| Compound Name | 4-(4-cyclohexylcyclohexyl)-7-methyl-6-(1-methyl-4-propan-2-ylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
|---|---|
| PubChem CID | 166038434 |
| Molecular Formula | C35H41N2O+ |
| Molecular Weight | 505.73 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | 4-(4-cyclohexylcyclohexyl)-7-methyl-6-(1-methyl-4-propan-2-ylpyridin-1-ium-2-yl)dibenzofuran-3-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(C4CCC(C5CCCCC5)CC4)c(C#N)ccc32)c1-c1cc(C(C)C)cc[n+]1C |
| InChI | InChI=1S/C35H41N2O/c1-22(2)27-18-19-37(4)31(20-27)32-23(3)10-16-29-30-17-15-28(21-36)33(35(30)38-34(29)32)26-13-11-25(12-14-26)24-8-6-5-7-9-24/h10,15-20,22,24-26H,5-9,11-14H2,1-4H3/q+1 |
| InChIKey | GRJCPCGITAFYKR-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.73 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|