C33H27N2O+ — CID 162505747
7-methyl-6-(2-methyl-6-propan-2-ylisoquinolin-2-ium-1-yl)-4-phenyldibenzofuran-2-carbonitrile (PubChem CID 162505747) has the molecular formula C33H27N2O+ and a molecular weight of 467.59 g/mol. Its IUPAC name is 7-methyl-6-(2-methyl-6-propan-2-ylisoquinolin-2-ium-1-yl)-4-phenyldibenzofuran-2-carbonitrile.
| Compound Name | 7-methyl-6-(2-methyl-6-propan-2-ylisoquinolin-2-ium-1-yl)-4-phenyldibenzofuran-2-carbonitrile |
|---|---|
| PubChem CID | 162505747 |
| Molecular Formula | C33H27N2O+ |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 7-methyl-6-(2-methyl-6-propan-2-ylisoquinolin-2-ium-1-yl)-4-phenyldibenzofuran-2-carbonitrile |
| SMILES | Cc1ccc2c(oc3c(-c4ccccc4)cc(C#N)cc32)c1-c1c2ccc(C(C)C)cc2cc[n+]1C |
| InChI | InChI=1S/C33H27N2O/c1-20(2)24-11-13-26-25(18-24)14-15-35(4)31(26)30-21(3)10-12-27-29-17-22(19-34)16-28(32(29)36-33(27)30)23-8-6-5-7-9-23/h5-18,20H,1-4H3/q+1 |
| InChIKey | MGFKFMQQHFGDOO-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 40.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|