C29H32NOS+ — CID 164722322
14-(4,4-diethylcyclohexyl)-3,19-dimethyl-7-oxa-11-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene (PubChem CID 164722322) has the molecular formula C29H32NOS+ and a molecular weight of 442.65 g/mol. Its IUPAC name is 14-(4,4-diethylcyclohexyl)-3,19-dimethyl-7-oxa-11-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene.
| Compound Name | 14-(4,4-diethylcyclohexyl)-3,19-dimethyl-7-oxa-11-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene |
|---|---|
| PubChem CID | 164722322 |
| Molecular Formula | C29H32NOS+ |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 14-(4,4-diethylcyclohexyl)-3,19-dimethyl-7-oxa-11-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene |
| SMILES | CCC1(CC)CCC(c2cc3c4c([n+](C)ccc4c2)-c2c(cc4occc4c2C)S3)CC1 |
| InChI | InChI=1S/C29H32NOS/c1-5-29(6-2)11-7-19(8-12-29)21-15-20-9-13-30(4)28-26-18(3)22-10-14-31-23(22)17-25(26)32-24(16-21)27(20)28/h9-10,13-17,19H,5-8,11-12H2,1-4H3/q+1 |
| InChIKey | ZCFWTWCVWHWTSL-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|