C21H15N2OS+ — CID 164723119
14-(isocyanomethyl)-3,19-dimethyl-12-oxa-15-thia-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,13,16(20),17-nonaene (PubChem CID 164723119) has the molecular formula C21H15N2OS+ and a molecular weight of 343.43 g/mol. Its IUPAC name is 14-(isocyanomethyl)-3,19-dimethyl-12-oxa-15-thia-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,13,16(20),17-nonaene.
| Compound Name | 14-(isocyanomethyl)-3,19-dimethyl-12-oxa-15-thia-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,13,16(20),17-nonaene |
|---|---|
| PubChem CID | 164723119 |
| Molecular Formula | C21H15N2OS+ |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 14-(isocyanomethyl)-3,19-dimethyl-12-oxa-15-thia-19-azoniapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2,4,6,8,10,13,16(20),17-nonaene |
| SMILES | [C-]#[N+]Cc1sc2cc[n+](C)c3c2c1Oc1cc2ccccc2c(C)c1-3 |
| InChI | InChI=1S/C21H15N2OS/c1-12-14-7-5-4-6-13(14)10-15-18(12)20-19-16(8-9-23(20)3)25-17(11-22-2)21(19)24-15/h4-10H,11H2,1,3H3/q+1 |
| InChIKey | ZJFKRQANXWMMRK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 17.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|