C29H36NO+ — CID 166053176
6-(4,4-diethylcyclohexyl)-3,11,15,16-tetramethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene (PubChem CID 166053176) has the molecular formula C29H36NO+ and a molecular weight of 414.61 g/mol. Its IUPAC name is 6-(4,4-diethylcyclohexyl)-3,11,15,16-tetramethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene.
| Compound Name | 6-(4,4-diethylcyclohexyl)-3,11,15,16-tetramethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 166053176 |
| Molecular Formula | C29H36NO+ |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 6-(4,4-diethylcyclohexyl)-3,11,15,16-tetramethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
| SMILES | CCC1(CC)CCC(c2cc[n+](C)c3c2Oc2cc(C)cc4cc(C)c(C)c-3c24)CC1 |
| InChI | InChI=1S/C29H36NO/c1-7-29(8-2)12-9-21(10-13-29)23-11-14-30(6)27-25-20(5)19(4)17-22-15-18(3)16-24(26(22)25)31-28(23)27/h11,14-17,21H,7-10,12-13H2,1-6H3/q+1 |
| InChIKey | GVSANMAGEWDWSP-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|