C29H30NO+ — CID 166053782
10-cyclohexyl-3,15,19,20-tetramethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene (PubChem CID 166053782) has the molecular formula C29H30NO+ and a molecular weight of 408.57 g/mol. Its IUPAC name is 10-cyclohexyl-3,15,19,20-tetramethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene.
| Compound Name | 10-cyclohexyl-3,15,19,20-tetramethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 166053782 |
| Molecular Formula | C29H30NO+ |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 10-cyclohexyl-3,15,19,20-tetramethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
| SMILES | Cc1cc2c3c(c(C)c(C)cc3c1)-c1c(c(C3CCCCC3)c3ccccc3[n+]1C)O2 |
| InChI | InChI=1S/C29H30NO/c1-17-14-21-16-18(2)19(3)25-27(21)24(15-17)31-29-26(20-10-6-5-7-11-20)22-12-8-9-13-23(22)30(4)28(25)29/h8-9,12-16,20H,5-7,10-11H2,1-4H3/q+1 |
| InChIKey | ZCYHHRWLKYYEGO-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|