C27H32NO+ — CID 166054064
6-(4,4-dimethylcyclohexyl)-3,11,15,16-tetramethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene (PubChem CID 166054064) has the molecular formula C27H32NO+ and a molecular weight of 386.56 g/mol. Its IUPAC name is 6-(4,4-dimethylcyclohexyl)-3,11,15,16-tetramethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene.
| Compound Name | 6-(4,4-dimethylcyclohexyl)-3,11,15,16-tetramethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 166054064 |
| Molecular Formula | C27H32NO+ |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | 6-(4,4-dimethylcyclohexyl)-3,11,15,16-tetramethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
| SMILES | Cc1cc2c3c(c(C)c(C)cc3c1)-c1c(c(C3CCC(C)(C)CC3)cc[n+]1C)O2 |
| InChI | InChI=1S/C27H32NO/c1-16-13-20-15-17(2)18(3)23-24(20)22(14-16)29-26-21(9-12-28(6)25(23)26)19-7-10-27(4,5)11-8-19/h9,12-15,19H,7-8,10-11H2,1-6H3/q+1 |
| InChIKey | NSUBKKACAXSINP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|