C28H34NO+ — CID 166053356
6-cyclohexyl-3,15,16-trimethyl-11-(2-methylpropyl)-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene (PubChem CID 166053356) has the molecular formula C28H34NO+ and a molecular weight of 400.59 g/mol. Its IUPAC name is 6-cyclohexyl-3,15,16-trimethyl-11-(2-methylpropyl)-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene.
| Compound Name | 6-cyclohexyl-3,15,16-trimethyl-11-(2-methylpropyl)-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 166053356 |
| Molecular Formula | C28H34NO+ |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 6-cyclohexyl-3,15,16-trimethyl-11-(2-methylpropyl)-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
| SMILES | Cc1cc2cc(CC(C)C)cc3c2c(c1C)-c1c(c(C2CCCCC2)cc[n+]1C)O3 |
| InChI | InChI=1S/C28H34NO/c1-17(2)13-20-15-22-14-18(3)19(4)25-26(22)24(16-20)30-28-23(11-12-29(5)27(25)28)21-9-7-6-8-10-21/h11-12,14-17,21H,6-10,13H2,1-5H3/q+1 |
| InChIKey | GKTNLROWLJLRTO-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|