C31H40NO+ — CID 166053771
6-(4,4-diethylcyclohexyl)-3,15,16-trimethyl-11-propan-2-yl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene (PubChem CID 166053771) has the molecular formula C31H40NO+ and a molecular weight of 442.67 g/mol. Its IUPAC name is 6-(4,4-diethylcyclohexyl)-3,15,16-trimethyl-11-propan-2-yl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene.
| Compound Name | 6-(4,4-diethylcyclohexyl)-3,15,16-trimethyl-11-propan-2-yl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene |
|---|---|
| PubChem CID | 166053771 |
| Molecular Formula | C31H40NO+ |
| Molecular Weight | 442.67 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | 6-(4,4-diethylcyclohexyl)-3,15,16-trimethyl-11-propan-2-yl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene |
| SMILES | CCC1(CC)CCC(c2cc[n+](C)c3c2Oc2cc(C(C)C)cc4cc(C)c(C)c-3c24)CC1 |
| InChI | InChI=1S/C31H40NO/c1-8-31(9-2)13-10-22(11-14-31)25-12-15-32(7)29-27-21(6)20(5)16-24-17-23(19(3)4)18-26(28(24)27)33-30(25)29/h12,15-19,22H,8-11,13-14H2,1-7H3/q+1 |
| InChIKey | IGAGVJZINGVMOJ-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.67 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|