C21H19N2O+ — CID 166053743
6-(isocyanomethyl)-3,11,15,16-tetramethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene (PubChem CID 166053743) has the molecular formula C21H19N2O+ and a molecular weight of 315.40 g/mol. Its IUPAC name is 6-(isocyanomethyl)-3,11,15,16-tetramethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene.
| Compound Name | 6-(isocyanomethyl)-3,11,15,16-tetramethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 166053743 |
| Molecular Formula | C21H19N2O+ |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 6-(isocyanomethyl)-3,11,15,16-tetramethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
| SMILES | [C-]#[N+]Cc1cc[n+](C)c2c1Oc1cc(C)cc3cc(C)c(C)c-2c13 |
| InChI | InChI=1S/C21H19N2O/c1-12-8-16-10-13(2)14(3)18-19(16)17(9-12)24-21-15(11-22-4)6-7-23(5)20(18)21/h6-10H,11H2,1-3,5H3/q+1 |
| InChIKey | UBRAAGINXBJJMW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 17.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|