C26H26NOS+ — CID 166054398
7-cyclopentyl-3,14,18,19-tetramethyl-11-oxa-8-thia-3-azoniapentacyclo[10.7.1.02,10.05,9.016,20]icosa-1(19),2,4,6,9,12,14,16(20),17-nonaene (PubChem CID 166054398) has the molecular formula C26H26NOS+ and a molecular weight of 400.57 g/mol. Its IUPAC name is 7-cyclopentyl-3,14,18,19-tetramethyl-11-oxa-8-thia-3-azoniapentacyclo[10.7.1.02,10.05,9.016,20]icosa-1(19),2,4,6,9,12,14,16(20),17-nonaene.
| Compound Name | 7-cyclopentyl-3,14,18,19-tetramethyl-11-oxa-8-thia-3-azoniapentacyclo[10.7.1.02,10.05,9.016,20]icosa-1(19),2,4,6,9,12,14,16(20),17-nonaene |
|---|---|
| PubChem CID | 166054398 |
| Molecular Formula | C26H26NOS+ |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 7-cyclopentyl-3,14,18,19-tetramethyl-11-oxa-8-thia-3-azoniapentacyclo[10.7.1.02,10.05,9.016,20]icosa-1(19),2,4,6,9,12,14,16(20),17-nonaene |
| SMILES | Cc1cc2c3c(c(C)c(C)cc3c1)-c1c(c3sc(C4CCCC4)cc3c[n+]1C)O2 |
| InChI | InChI=1S/C26H26NOS/c1-14-9-18-11-15(2)16(3)22-23(18)20(10-14)28-25-24(22)27(4)13-19-12-21(29-26(19)25)17-7-5-6-8-17/h9-13,17H,5-8H2,1-4H3/q+1 |
| InChIKey | VNBOBXSWLMBFFE-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|