C24H26NO2Si+ — CID 166054083
trimethyl-(3,14,18,19-tetramethyl-6,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.05,9.016,20]icosa-1(19),2,4,7,9,12,14,16(20),17-nonaen-7-yl)silane (PubChem CID 166054083) has the molecular formula C24H26NO2Si+ and a molecular weight of 388.56 g/mol. Its IUPAC name is trimethyl-(3,14,18,19-tetramethyl-6,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.05,9.016,20]icosa-1(19),2,4,7,9,12,14,16(20),17-nonaen-7-yl)silane.
| Compound Name | trimethyl-(3,14,18,19-tetramethyl-6,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.05,9.016,20]icosa-1(19),2,4,7,9,12,14,16(20),17-nonaen-7-yl)silane |
|---|---|
| PubChem CID | 166054083 |
| Molecular Formula | C24H26NO2Si+ |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | trimethyl-(3,14,18,19-tetramethyl-6,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.05,9.016,20]icosa-1(19),2,4,7,9,12,14,16(20),17-nonaen-7-yl)silane |
| SMILES | Cc1cc2c3c(c(C)c(C)cc3c1)-c1c(c3cc([Si](C)(C)C)oc3c[n+]1C)O2 |
| InChI | InChI=1S/C24H26NO2Si/c1-13-8-16-10-14(2)15(3)21-22(16)18(9-13)27-24-17-11-20(28(5,6)7)26-19(17)12-25(4)23(21)24/h8-12H,1-7H3/q+1 |
| InChIKey | QDQSTLVEAXHZPQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|