C29H34N3+ — CID 166054424
3-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-4-(5-propan-2-ylpyrimidin-2-yl)isoquinolin-2-ium (PubChem CID 166054424) has the molecular formula C29H34N3+ and a molecular weight of 424.61 g/mol. Its IUPAC name is 3-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-4-(5-propan-2-ylpyrimidin-2-yl)isoquinolin-2-ium.
| Compound Name | 3-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-4-(5-propan-2-ylpyrimidin-2-yl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 166054424 |
| Molecular Formula | C29H34N3+ |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 3-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-4-(5-propan-2-ylpyrimidin-2-yl)isoquinolin-2-ium |
| SMILES | Cc1cc(C(C)(C)C)cc(-c2c(-c3ncc(C(C)C)cn3)c3ccccc3c[n+]2C)c1C |
| InChI | InChI=1S/C29H34N3/c1-18(2)22-15-30-28(31-16-22)26-24-12-10-9-11-21(24)17-32(8)27(26)25-14-23(29(5,6)7)13-19(3)20(25)4/h9-18H,1-8H3/q+1 |
| InChIKey | AFGIPZROFDAKRW-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|