C30H38N+ — CID 155638773
6-(2-bicyclo[2.2.2]octanyl)-1-(5-tert-butyl-2,3-dimethylphenyl)-2-methylisoquinolin-2-ium (PubChem CID 155638773) has the molecular formula C30H38N+ and a molecular weight of 412.64 g/mol. Its IUPAC name is 6-(2-bicyclo[2.2.2]octanyl)-1-(5-tert-butyl-2,3-dimethylphenyl)-2-methylisoquinolin-2-ium.
| Compound Name | 6-(2-bicyclo[2.2.2]octanyl)-1-(5-tert-butyl-2,3-dimethylphenyl)-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 155638773 |
| Molecular Formula | C30H38N+ |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | 6-(2-bicyclo[2.2.2]octanyl)-1-(5-tert-butyl-2,3-dimethylphenyl)-2-methylisoquinolin-2-ium |
| SMILES | Cc1cc(C(C)(C)C)cc(-c2c3ccc(C4CC5CCC4CC5)cc3cc[n+]2C)c1C |
| InChI | InChI=1S/C30H38N/c1-19-15-25(30(3,4)5)18-27(20(19)2)29-26-12-11-23(17-24(26)13-14-31(29)6)28-16-21-7-9-22(28)10-8-21/h11-15,17-18,21-22,28H,7-10,16H2,1-6H3/q+1 |
| InChIKey | QNNFBTXZWOINNX-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|