C33H31F3NSi+ — CID 155638176
[1-[2,3-dimethyl-5-(2,2,2-trifluoroethyl)phenyl]-2-methylisoquinolin-2-ium-6-yl]-methyl-diphenylsilane (PubChem CID 155638176) has the molecular formula C33H31F3NSi+ and a molecular weight of 526.70 g/mol. Its IUPAC name is [1-[2,3-dimethyl-5-(2,2,2-trifluoroethyl)phenyl]-2-methylisoquinolin-2-ium-6-yl]-methyl-diphenylsilane.
| Compound Name | [1-[2,3-dimethyl-5-(2,2,2-trifluoroethyl)phenyl]-2-methylisoquinolin-2-ium-6-yl]-methyl-diphenylsilane |
|---|---|
| PubChem CID | 155638176 |
| Molecular Formula | C33H31F3NSi+ |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | [1-[2,3-dimethyl-5-(2,2,2-trifluoroethyl)phenyl]-2-methylisoquinolin-2-ium-6-yl]-methyl-diphenylsilane |
| SMILES | Cc1cc(CC(F)(F)F)cc(-c2c3ccc([Si](C)(c4ccccc4)c4ccccc4)cc3cc[n+]2C)c1C |
| InChI | InChI=1S/C33H31F3NSi/c1-23-19-25(22-33(34,35)36)20-31(24(23)2)32-30-16-15-29(21-26(30)17-18-37(32)3)38(4,27-11-7-5-8-12-27)28-13-9-6-10-14-28/h5-21H,22H2,1-4H3/q+1 |
| InChIKey | UREXRFNNICWGKA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|