C23H23NO2 — CID 136706319
2-[[2-(2-methoxyphenyl)phenyl]iminomethyl]-6-propan-2-ylphenol (PubChem CID 136706319) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 2-[[2-(2-methoxyphenyl)phenyl]iminomethyl]-6-propan-2-ylphenol.
| Compound Name | 2-[[2-(2-methoxyphenyl)phenyl]iminomethyl]-6-propan-2-ylphenol |
|---|---|
| PubChem CID | 136706319 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 2-[[2-(2-methoxyphenyl)phenyl]iminomethyl]-6-propan-2-ylphenol |
| SMILES | COc1ccccc1-c1ccccc1/N=C/c1cccc(C(C)C)c1O |
| InChI | InChI=1S/C23H23NO2/c1-16(2)18-12-8-9-17(23(18)25)15-24-21-13-6-4-10-19(21)20-11-5-7-14-22(20)26-3/h4-16,25H,1-3H3/b24-15+ |
| InChIKey | NAKZFRXZVXMQRM-BUVRLJJBSA-N |
| XLogP | 5.94 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|