C31H33Cl3NO2Ti — CID 139252637
2-(1-adamantyl)-6-[[2-(2-methoxyphenyl)phenyl]iminomethyl]-4-methylphenol;trichlorotitanium (PubChem CID 139252637) has the molecular formula C31H33Cl3NO2Ti and a molecular weight of 605.84 g/mol. Its IUPAC name is 2-(1-adamantyl)-6-[[2-(2-methoxyphenyl)phenyl]iminomethyl]-4-methylphenol;trichlorotitanium.
| Compound Name | 2-(1-adamantyl)-6-[[2-(2-methoxyphenyl)phenyl]iminomethyl]-4-methylphenol;trichlorotitanium |
|---|---|
| PubChem CID | 139252637 |
| Molecular Formula | C31H33Cl3NO2Ti |
| Molecular Weight | 605.84 g/mol |
| Exact Mass | 604.11 |
| IUPAC Name | 2-(1-adamantyl)-6-[[2-(2-methoxyphenyl)phenyl]iminomethyl]-4-methylphenol;trichlorotitanium |
| SMILES | COc1ccccc1-c1ccccc1/N=C/c1cc(C)cc(C23CC4CC(CC(C4)C2)C3)c1O.Cl[Ti](Cl)Cl |
| InChI | InChI=1S/C31H33NO2.3ClH.Ti/c1-20-11-24(19-32-28-9-5-3-7-25(28)26-8-4-6-10-29(26)34-2)30(33)27(12-20)31-16-21-13-22(17-31)15-23(14-21)18-31;;;;/h3-12,19,21-23,33H,13-18H2,1-2H3;3*1H;/q;;;;+3/p-3/b32-19+;;;; |
| InChIKey | HYVNINRLIDMQDB-FYTFDOFUSA-K |
| XLogP | 9.66 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.84 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|