C45H47NO — CID 144691029
2-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-phenyl-6-[[2-[3-(2-phenylpropan-2-yl)phenyl]phenyl]iminomethyl]phenol (PubChem CID 144691029) has the molecular formula C45H47NO and a molecular weight of 617.88 g/mol. Its IUPAC name is 2-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-phenyl-6-[[2-[3-(2-phenylpropan-2-yl)phenyl]phenyl]iminomethyl]phenol.
| Compound Name | 2-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-phenyl-6-[[2-[3-(2-phenylpropan-2-yl)phenyl]phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 144691029 |
| Molecular Formula | C45H47NO |
| Molecular Weight | 617.88 g/mol |
| Exact Mass | 617.37 |
| IUPAC Name | 2-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-4-phenyl-6-[[2-[3-(2-phenylpropan-2-yl)phenyl]phenyl]iminomethyl]phenol |
| SMILES | CC1CC2CC(C)CC(c3cc(-c4ccccc4)cc(/C=N/c4ccccc4-c4cccc(C(C)(C)c5ccccc5)c4)c3O)(C1)C2 |
| InChI | InChI=1S/C45H47NO/c1-31-22-33-23-32(2)28-45(27-31,29-33)41-26-36(34-14-7-5-8-15-34)24-37(43(41)47)30-46-42-21-12-11-20-40(42)35-16-13-19-39(25-35)44(3,4)38-17-9-6-10-18-38/h5-21,24-26,30-33,47H,22-23,27-29H2,1-4H3/b46-30+ |
| InChIKey | RRKLIXCNVYCFFO-MCQKKTSZSA-N |
| XLogP | 11.91 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.88 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|