C30H30N2O — CID 136726129
2-[6-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-2-pyridinyl]-6-phenylphenol (PubChem CID 136726129) has the molecular formula C30H30N2O and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-[6-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-2-pyridinyl]-6-phenylphenol.
| Compound Name | 2-[6-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-2-pyridinyl]-6-phenylphenol |
|---|---|
| PubChem CID | 136726129 |
| Molecular Formula | C30H30N2O |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | 2-[6-[[2,6-di(propan-2-yl)phenyl]iminomethyl]-2-pyridinyl]-6-phenylphenol |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/c1cccc(-c2cccc(-c3ccccc3)c2O)n1 |
| InChI | InChI=1S/C30H30N2O/c1-20(2)24-14-9-15-25(21(3)4)29(24)31-19-23-13-8-18-28(32-23)27-17-10-16-26(30(27)33)22-11-6-5-7-12-22/h5-21,33H,1-4H3/b31-19+ |
| InChIKey | LYKHWXPFWANCBK-ZCTHSVRISA-N |
| XLogP | 8.12 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|