C47H51N2O2Pt- — CID 155610114
carbanide;3-[2,6-di(propan-2-yl)phenyl]-8-[[6-[4-[2,6-di(propan-2-yl)phenyl]-2-hydroxyphenyl]-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum (PubChem CID 155610114) has the molecular formula C47H51N2O2Pt- and a molecular weight of 871.01 g/mol. Its IUPAC name is carbanide;3-[2,6-di(propan-2-yl)phenyl]-8-[[6-[4-[2,6-di(propan-2-yl)phenyl]-2-hydroxyphenyl]-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum.
| Compound Name | carbanide;3-[2,6-di(propan-2-yl)phenyl]-8-[[6-[4-[2,6-di(propan-2-yl)phenyl]-2-hydroxyphenyl]-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum |
|---|---|
| PubChem CID | 155610114 |
| Molecular Formula | C47H51N2O2Pt- |
| Molecular Weight | 871.01 g/mol |
| Exact Mass | 870.36 |
| IUPAC Name | carbanide;3-[2,6-di(propan-2-yl)phenyl]-8-[[6-[4-[2,6-di(propan-2-yl)phenyl]-2-hydroxyphenyl]-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1ccc(-c2cccc(/C=N/c3cccc4cc(-c5c(C(C)C)cccc5C(C)C)cc(O)c34)n2)c(O)c1.[CH3-].[Pt] |
| InChI | InChI=1S/C46H48N2O2.CH3.Pt/c1-27(2)35-15-11-16-36(28(3)4)44(35)32-21-22-39(42(49)24-32)40-19-10-14-34(48-40)26-47-41-20-9-13-31-23-33(25-43(50)46(31)41)45-37(29(5)6)17-12-18-38(45)30(7)8;;/h9-30,49-50H,1-8H3;1H3;/q;-1;/b47-26+;; |
| InChIKey | DXVLVXPGALYUEF-PORWEGJKSA-N |
| XLogP | 13.34 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.01 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|