C37H30N2O2Pt — CID 155609993
8-[[6-[2-hydroxy-4-(2,4,6-trimethylphenyl)phenyl]-4-phenyl-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum (PubChem CID 155609993) has the molecular formula C37H30N2O2Pt and a molecular weight of 729.74 g/mol. Its IUPAC name is 8-[[6-[2-hydroxy-4-(2,4,6-trimethylphenyl)phenyl]-4-phenyl-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum.
| Compound Name | 8-[[6-[2-hydroxy-4-(2,4,6-trimethylphenyl)phenyl]-4-phenyl-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum |
|---|---|
| PubChem CID | 155609993 |
| Molecular Formula | C37H30N2O2Pt |
| Molecular Weight | 729.74 g/mol |
| Exact Mass | 729.20 |
| IUPAC Name | 8-[[6-[2-hydroxy-4-(2,4,6-trimethylphenyl)phenyl]-4-phenyl-2-pyridinyl]methylideneamino]naphthalen-1-ol;platinum |
| SMILES | Cc1cc(C)c(-c2ccc(-c3cc(-c4ccccc4)cc(/C=N/c4cccc5cccc(O)c45)n3)c(O)c2)c(C)c1.[Pt] |
| InChI | InChI=1S/C37H30N2O2.Pt/c1-23-17-24(2)36(25(3)18-23)28-15-16-31(35(41)21-28)33-20-29(26-9-5-4-6-10-26)19-30(39-33)22-38-32-13-7-11-27-12-8-14-34(40)37(27)32;/h4-22,40-41H,1-3H3;/b38-22+; |
| InChIKey | DADWCGVPORSOSV-UDIOAMHASA-N |
| XLogP | 9.32 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.74 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|