C31H24N2O2Pt — CID 155610138
2-[6-[(8-hydroxynaphthalen-1-yl)iminomethyl]-2-pyridinyl]-9,9-dimethylfluoren-3-ol;platinum (PubChem CID 155610138) has the molecular formula C31H24N2O2Pt and a molecular weight of 651.62 g/mol. Its IUPAC name is 2-[6-[(8-hydroxynaphthalen-1-yl)iminomethyl]-2-pyridinyl]-9,9-dimethylfluoren-3-ol;platinum.
| Compound Name | 2-[6-[(8-hydroxynaphthalen-1-yl)iminomethyl]-2-pyridinyl]-9,9-dimethylfluoren-3-ol;platinum |
|---|---|
| PubChem CID | 155610138 |
| Molecular Formula | C31H24N2O2Pt |
| Molecular Weight | 651.62 g/mol |
| Exact Mass | 651.15 |
| IUPAC Name | 2-[6-[(8-hydroxynaphthalen-1-yl)iminomethyl]-2-pyridinyl]-9,9-dimethylfluoren-3-ol;platinum |
| SMILES | CC1(C)c2ccccc2-c2cc(O)c(-c3cccc(/C=N/c4cccc5cccc(O)c45)n3)cc21.[Pt] |
| InChI | InChI=1S/C31H24N2O2.Pt/c1-31(2)24-12-4-3-11-21(24)22-17-29(35)23(16-25(22)31)26-13-7-10-20(33-26)18-32-27-14-5-8-19-9-6-15-28(34)30(19)27;/h3-18,34-35H,1-2H3;/b32-18+; |
| InChIKey | RAJVXWJUQWFZRC-QGSDWOHQSA-N |
| XLogP | 7.37 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.62 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|