C35H26N2O2 — CID 155610007
2-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]-9,9-dimethylfluoren-1-ol (PubChem CID 155610007) has the molecular formula C35H26N2O2 and a molecular weight of 506.61 g/mol. Its IUPAC name is 2-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]-9,9-dimethylfluoren-1-ol.
| Compound Name | 2-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]-9,9-dimethylfluoren-1-ol |
|---|---|
| PubChem CID | 155610007 |
| Molecular Formula | C35H26N2O2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 2-[1-[(8-hydroxynaphthalen-1-yl)iminomethyl]isoquinolin-3-yl]-9,9-dimethylfluoren-1-ol |
| SMILES | CC1(C)c2ccccc2-c2ccc(-c3cc4ccccc4c(/C=N/c4cccc5cccc(O)c45)n3)c(O)c21 |
| InChI | InChI=1S/C35H26N2O2/c1-35(2)27-14-6-5-13-24(27)25-17-18-26(34(39)33(25)35)29-19-22-9-3-4-12-23(22)30(37-29)20-36-28-15-7-10-21-11-8-16-31(38)32(21)28/h3-20,38-39H,1-2H3/b36-20+ |
| InChIKey | VLCQBHNZVCYJHQ-ZSNJKBEMSA-N |
| XLogP | 8.52 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|