C24H26Cl2CoN2 — CID 59444818
dichlorocobalt;N-[2,6-di(propan-2-yl)phenyl]-1-(6-phenyl-2-pyridinyl)methanimine (PubChem CID 59444818) has the molecular formula C24H26Cl2CoN2 and a molecular weight of 472.33 g/mol. Its IUPAC name is dichlorocobalt;N-[2,6-di(propan-2-yl)phenyl]-1-(6-phenyl-2-pyridinyl)methanimine.
| Compound Name | dichlorocobalt;N-[2,6-di(propan-2-yl)phenyl]-1-(6-phenyl-2-pyridinyl)methanimine |
|---|---|
| PubChem CID | 59444818 |
| Molecular Formula | C24H26Cl2CoN2 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | dichlorocobalt;N-[2,6-di(propan-2-yl)phenyl]-1-(6-phenyl-2-pyridinyl)methanimine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/c1cccc(-c2ccccc2)n1.Cl[Co]Cl |
| InChI | InChI=1S/C24H26N2.2ClH.Co/c1-17(2)21-13-9-14-22(18(3)4)24(21)25-16-20-12-8-15-23(26-20)19-10-6-5-7-11-19;;;/h5-18H,1-4H3;2*1H;/q;;;+2/p-2/b25-16+;;; |
| InChIKey | XVBUACAXQJDIMR-JDVRIFNQSA-L |
| XLogP | 8.12 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|