C28H34N2 — CID 102492718
1-(4-butyl-6-phenyl-2-pyridinyl)-N-[2,6-di(propan-2-yl)phenyl]methanimine (PubChem CID 102492718) has the molecular formula C28H34N2 and a molecular weight of 398.59 g/mol. Its IUPAC name is 1-(4-butyl-6-phenyl-2-pyridinyl)-N-[2,6-di(propan-2-yl)phenyl]methanimine.
| Compound Name | 1-(4-butyl-6-phenyl-2-pyridinyl)-N-[2,6-di(propan-2-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 102492718 |
| Molecular Formula | C28H34N2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 1-(4-butyl-6-phenyl-2-pyridinyl)-N-[2,6-di(propan-2-yl)phenyl]methanimine |
| SMILES | CCCCc1cc(/C=N/c2c(C(C)C)cccc2C(C)C)nc(-c2ccccc2)c1 |
| InChI | InChI=1S/C28H34N2/c1-6-7-12-22-17-24(30-27(18-22)23-13-9-8-10-14-23)19-29-28-25(20(2)3)15-11-16-26(28)21(4)5/h8-11,13-21H,6-7,12H2,1-5H3/b29-19+ |
| InChIKey | KIVDOXRIWRAFJM-VUTHCHCSSA-N |
| XLogP | 8.09 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|