C35H47N3 — CID 70011433
N-(2,6-dibutylphenyl)-1-[6-[(2,6-dibutylphenyl)iminomethyl]-2-pyridinyl]methanimine (PubChem CID 70011433) has the molecular formula C35H47N3 and a molecular weight of 509.78 g/mol. Its IUPAC name is N-(2,6-dibutylphenyl)-1-[6-[(2,6-dibutylphenyl)iminomethyl]-2-pyridinyl]methanimine.
| Compound Name | N-(2,6-dibutylphenyl)-1-[6-[(2,6-dibutylphenyl)iminomethyl]-2-pyridinyl]methanimine |
|---|---|
| PubChem CID | 70011433 |
| Molecular Formula | C35H47N3 |
| Molecular Weight | 509.78 g/mol |
| Exact Mass | 509.38 |
| IUPAC Name | N-(2,6-dibutylphenyl)-1-[6-[(2,6-dibutylphenyl)iminomethyl]-2-pyridinyl]methanimine |
| SMILES | CCCCc1cccc(CCCC)c1/N=C/c1cccc(/C=N/c2c(CCCC)cccc2CCCC)n1 |
| InChI | InChI=1S/C35H47N3/c1-5-9-16-28-20-13-21-29(17-10-6-2)34(28)36-26-32-24-15-25-33(38-32)27-37-35-30(18-11-7-3)22-14-23-31(35)19-12-8-4/h13-15,20-27H,5-12,16-19H2,1-4H3/b36-26+,37-27+ |
| InChIKey | LBPGSVXZNVTDGL-FIGANRNSSA-N |
| XLogP | 9.95 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.78 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|