C15H14O3 — CID 25224834
2-[(E)-1-hydroxy-3-phenylprop-2-enyl]benzene-1,4-diol (PubChem CID 25224834) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-[(E)-1-hydroxy-3-phenylprop-2-enyl]benzene-1,4-diol.
| Compound Name | 2-[(E)-1-hydroxy-3-phenylprop-2-enyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 25224834 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-[(E)-1-hydroxy-3-phenylprop-2-enyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(C(O)/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C15H14O3/c16-12-7-9-15(18)13(10-12)14(17)8-6-11-4-2-1-3-5-11/h1-10,14,16-18H/b8-6+ |
| InChIKey | KAWRHUYKKQUICA-SOFGYWHQSA-N |
| XLogP | 2.84 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|