C15H10F4O — CID 122381477
(E)-3-phenyl-1-(2,3,5,6-tetrafluorophenyl)prop-2-en-1-ol (PubChem CID 122381477) has the molecular formula C15H10F4O and a molecular weight of 282.24 g/mol. Its IUPAC name is (E)-3-phenyl-1-(2,3,5,6-tetrafluorophenyl)prop-2-en-1-ol.
| Compound Name | (E)-3-phenyl-1-(2,3,5,6-tetrafluorophenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 122381477 |
| Molecular Formula | C15H10F4O |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | (E)-3-phenyl-1-(2,3,5,6-tetrafluorophenyl)prop-2-en-1-ol |
| SMILES | OC(/C=C/c1ccccc1)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C15H10F4O/c16-10-8-11(17)15(19)13(14(10)18)12(20)7-6-9-4-2-1-3-5-9/h1-8,12,20H/b7-6+ |
| InChIKey | MQMVYLVEOIBUEH-VOTSOKGWSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|