C17H9F5O — CID 11045561
(E)-1-(2,3,4,5,6-pentafluorophenyl)-5-phenylpent-4-en-2-yn-1-ol (PubChem CID 11045561) has the molecular formula C17H9F5O and a molecular weight of 324.25 g/mol. Its IUPAC name is (E)-1-(2,3,4,5,6-pentafluorophenyl)-5-phenylpent-4-en-2-yn-1-ol.
| Compound Name | (E)-1-(2,3,4,5,6-pentafluorophenyl)-5-phenylpent-4-en-2-yn-1-ol |
|---|---|
| PubChem CID | 11045561 |
| Molecular Formula | C17H9F5O |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | (E)-1-(2,3,4,5,6-pentafluorophenyl)-5-phenylpent-4-en-2-yn-1-ol |
| SMILES | OC(C#C/C=C/c1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H9F5O/c18-13-12(14(19)16(21)17(22)15(13)20)11(23)9-5-4-8-10-6-2-1-3-7-10/h1-4,6-8,11,23H/b8-4+ |
| InChIKey | XILGHVVSAIISCG-XBXARRHUSA-N |
| XLogP | 4.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|