C17H11F5 — CID 138963154
1,2,3,4,5-pentafluoro-6-[(2E,4E)-5-phenylpenta-2,4-dienyl]benzene (PubChem CID 138963154) has the molecular formula C17H11F5 and a molecular weight of 310.27 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[(2E,4E)-5-phenylpenta-2,4-dienyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[(2E,4E)-5-phenylpenta-2,4-dienyl]benzene |
|---|---|
| PubChem CID | 138963154 |
| Molecular Formula | C17H11F5 |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[(2E,4E)-5-phenylpenta-2,4-dienyl]benzene |
| SMILES | Fc1c(F)c(F)c(C/C=C/C=C/c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C17H11F5/c18-13-12(14(19)16(21)17(22)15(13)20)10-6-2-5-9-11-7-3-1-4-8-11/h1-9H,10H2/b6-2+,9-5+ |
| InChIKey | UMOYYTGRWZAELX-VDESZNBCSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|