C23H24O5 — CID 139659266
4-ethyl-6-[(5-ethyl-2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol (PubChem CID 139659266) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is 4-ethyl-6-[(5-ethyl-2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol.
| Compound Name | 4-ethyl-6-[(5-ethyl-2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 139659266 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 4-ethyl-6-[(5-ethyl-2,4-dihydroxyphenyl)-(4-hydroxyphenyl)methyl]benzene-1,3-diol |
| SMILES | CCc1cc(C(c2ccc(O)cc2)c2cc(CC)c(O)cc2O)c(O)cc1O |
| InChI | InChI=1S/C23H24O5/c1-3-13-9-17(21(27)11-19(13)25)23(15-5-7-16(24)8-6-15)18-10-14(4-2)20(26)12-22(18)28/h5-12,23-28H,3-4H2,1-2H3 |
| InChIKey | XSJAUGAOCUTFGK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|