C18H20O4 — CID 87187255
2-(4-ethoxyphenyl)-2-(5-ethyl-2,4-dihydroxyphenyl)acetaldehyde (PubChem CID 87187255) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-2-(5-ethyl-2,4-dihydroxyphenyl)acetaldehyde.
| Compound Name | 2-(4-ethoxyphenyl)-2-(5-ethyl-2,4-dihydroxyphenyl)acetaldehyde |
|---|---|
| PubChem CID | 87187255 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2-(4-ethoxyphenyl)-2-(5-ethyl-2,4-dihydroxyphenyl)acetaldehyde |
| SMILES | CCOc1ccc(C(C=O)c2cc(CC)c(O)cc2O)cc1 |
| InChI | InChI=1S/C18H20O4/c1-3-12-9-15(18(21)10-17(12)20)16(11-19)13-5-7-14(8-6-13)22-4-2/h5-11,16,20-21H,3-4H2,1-2H3 |
| InChIKey | OIUIAYRTVDWTNV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|