C19H12I4O3 — CID 170357941
4-[(4-hydroxy-3,5-diiodophenyl)-(4-hydroxyphenyl)methyl]-2,6-diiodophenol (PubChem CID 170357941) has the molecular formula C19H12I4O3 and a molecular weight of 795.92 g/mol. Its IUPAC name is 4-[(4-hydroxy-3,5-diiodophenyl)-(4-hydroxyphenyl)methyl]-2,6-diiodophenol.
| Compound Name | 4-[(4-hydroxy-3,5-diiodophenyl)-(4-hydroxyphenyl)methyl]-2,6-diiodophenol |
|---|---|
| PubChem CID | 170357941 |
| Molecular Formula | C19H12I4O3 |
| Molecular Weight | 795.92 g/mol |
| Exact Mass | 795.70 |
| IUPAC Name | 4-[(4-hydroxy-3,5-diiodophenyl)-(4-hydroxyphenyl)methyl]-2,6-diiodophenol |
| SMILES | Oc1ccc(C(c2cc(I)c(O)c(I)c2)c2cc(I)c(O)c(I)c2)cc1 |
| InChI | InChI=1S/C19H12I4O3/c20-13-5-10(6-14(21)18(13)25)17(9-1-3-12(24)4-2-9)11-7-15(22)19(26)16(23)8-11/h1-8,17,24-26H |
| InChIKey | WPLZERSTWYMVKU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.92 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|