C13H10I2O2 — CID 54004873
4-[(4-hydroxyphenyl)methyl]-2,6-diiodophenol (PubChem CID 54004873) has the molecular formula C13H10I2O2 and a molecular weight of 452.03 g/mol. Its IUPAC name is 4-[(4-hydroxyphenyl)methyl]-2,6-diiodophenol.
| Compound Name | 4-[(4-hydroxyphenyl)methyl]-2,6-diiodophenol |
|---|---|
| PubChem CID | 54004873 |
| Molecular Formula | C13H10I2O2 |
| Molecular Weight | 452.03 g/mol |
| Exact Mass | 451.88 |
| IUPAC Name | 4-[(4-hydroxyphenyl)methyl]-2,6-diiodophenol |
| SMILES | Oc1ccc(Cc2cc(I)c(O)c(I)c2)cc1 |
| InChI | InChI=1S/C13H10I2O2/c14-11-6-9(7-12(15)13(11)17)5-8-1-3-10(16)4-2-8/h1-4,6-7,16-17H,5H2 |
| InChIKey | KODQUKSTBBDUMO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.03 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|