C10H13ClN4O4 — CID 19522471
4-[[2-(5-methyl-4-nitropyrazol-1-yl)acetyl]amino]butanoyl chloride (PubChem CID 19522471) has the molecular formula C10H13ClN4O4 and a molecular weight of 288.69 g/mol. Its IUPAC name is 4-[[2-(5-methyl-4-nitropyrazol-1-yl)acetyl]amino]butanoyl chloride.
| Compound Name | 4-[[2-(5-methyl-4-nitropyrazol-1-yl)acetyl]amino]butanoyl chloride |
|---|---|
| PubChem CID | 19522471 |
| Molecular Formula | C10H13ClN4O4 |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 4-[[2-(5-methyl-4-nitropyrazol-1-yl)acetyl]amino]butanoyl chloride |
| SMILES | Cc1c([N+](=O)[O-])cnn1CC(=O)NCCCC(=O)Cl |
| InChI | InChI=1S/C10H13ClN4O4/c1-7-8(15(18)19)5-13-14(7)6-10(17)12-4-2-3-9(11)16/h5H,2-4,6H2,1H3,(H,12,17) |
| InChIKey | IQBATQUISZYECL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|