C12H15ClN6O3 — CID 19283446
N-[2-(4-chloropyrazol-1-yl)ethyl]-3-(5-methyl-4-nitropyrazol-1-yl)propanamide (PubChem CID 19283446) has the molecular formula C12H15ClN6O3 and a molecular weight of 326.74 g/mol. Its IUPAC name is N-[2-(4-chloropyrazol-1-yl)ethyl]-3-(5-methyl-4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[2-(4-chloropyrazol-1-yl)ethyl]-3-(5-methyl-4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19283446 |
| Molecular Formula | C12H15ClN6O3 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-[2-(4-chloropyrazol-1-yl)ethyl]-3-(5-methyl-4-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1c([N+](=O)[O-])cnn1CCC(=O)NCCn1cc(Cl)cn1 |
| InChI | InChI=1S/C12H15ClN6O3/c1-9-11(19(21)22)7-16-18(9)4-2-12(20)14-3-5-17-8-10(13)6-15-17/h6-8H,2-5H2,1H3,(H,14,20) |
| InChIKey | FTTLCZOSTZUNAA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|