C14H12F2N6O7 — CID 19529152
2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]-N-(4-methyl-3,5-dinitrophenyl)acetamide (PubChem CID 19529152) has the molecular formula C14H12F2N6O7 and a molecular weight of 414.28 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]-N-(4-methyl-3,5-dinitrophenyl)acetamide.
| Compound Name | 2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]-N-(4-methyl-3,5-dinitrophenyl)acetamide |
|---|---|
| PubChem CID | 19529152 |
| Molecular Formula | C14H12F2N6O7 |
| Molecular Weight | 414.28 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]-N-(4-methyl-3,5-dinitrophenyl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])cc(NC(=O)Cn2nc(C(F)F)c([N+](=O)[O-])c2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12F2N6O7/c1-6-9(20(24)25)3-8(4-10(6)21(26)27)17-11(23)5-19-7(2)13(22(28)29)12(18-19)14(15)16/h3-4,14H,5H2,1-2H3,(H,17,23) |
| InChIKey | AMECBIAWJCSGEQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 176.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|