C13H11F2N5O6 — CID 19529264
2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]-N-(2-hydroxy-4-nitrophenyl)acetamide (PubChem CID 19529264) has the molecular formula C13H11F2N5O6 and a molecular weight of 371.26 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]-N-(2-hydroxy-4-nitrophenyl)acetamide.
| Compound Name | 2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]-N-(2-hydroxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 19529264 |
| Molecular Formula | C13H11F2N5O6 |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]-N-(2-hydroxy-4-nitrophenyl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])c(C(F)F)nn1CC(=O)Nc1ccc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C13H11F2N5O6/c1-6-12(20(25)26)11(13(14)15)17-18(6)5-10(22)16-8-3-2-7(19(23)24)4-9(8)21/h2-4,13,21H,5H2,1H3,(H,16,22) |
| InChIKey | VASJDTZZHUFMAA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 153.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|