C14H11ClF4N4O3 — CID 19526083
2-[4-chloro-3,5-bis(difluoromethyl)pyrazol-1-yl]-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 19526083) has the molecular formula C14H11ClF4N4O3 and a molecular weight of 394.71 g/mol. Its IUPAC name is 2-[4-chloro-3,5-bis(difluoromethyl)pyrazol-1-yl]-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[4-chloro-3,5-bis(difluoromethyl)pyrazol-1-yl]-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 19526083 |
| Molecular Formula | C14H11ClF4N4O3 |
| Molecular Weight | 394.71 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 2-[4-chloro-3,5-bis(difluoromethyl)pyrazol-1-yl]-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)Cn1nc(C(F)F)c(Cl)c1C(F)F |
| InChI | InChI=1S/C14H11ClF4N4O3/c1-6-4-7(23(25)26)2-3-8(6)20-9(24)5-22-12(14(18)19)10(15)11(21-22)13(16)17/h2-4,13-14H,5H2,1H3,(H,20,24) |
| InChIKey | SOMJAUOWKKVGNH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.71 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|