C16H16F2N4O7S — CID 19529017
dimethyl 5-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 19529017) has the molecular formula C16H16F2N4O7S and a molecular weight of 446.39 g/mol. Its IUPAC name is dimethyl 5-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 19529017 |
| Molecular Formula | C16H16F2N4O7S |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | dimethyl 5-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=O)Cn2nc(C(F)F)c([N+](=O)[O-])c2C)c(C(=O)OC)c1C |
| InChI | InChI=1S/C16H16F2N4O7S/c1-6-9(15(24)28-3)14(30-12(6)16(25)29-4)19-8(23)5-21-7(2)11(22(26)27)10(20-21)13(17)18/h13H,5H2,1-4H3,(H,19,23) |
| InChIKey | WECJYKXPTGPMFY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|