C16H14F3N3O5S — CID 17192801
3-[(4-nitrophenyl)sulfonylamino]-N-[2-(trifluoromethyl)phenyl]propanamide (PubChem CID 17192801) has the molecular formula C16H14F3N3O5S and a molecular weight of 417.37 g/mol. Its IUPAC name is 3-[(4-nitrophenyl)sulfonylamino]-N-[2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-[(4-nitrophenyl)sulfonylamino]-N-[2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 17192801 |
| Molecular Formula | C16H14F3N3O5S |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | 3-[(4-nitrophenyl)sulfonylamino]-N-[2-(trifluoromethyl)phenyl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H14F3N3O5S/c17-16(18,19)13-3-1-2-4-14(13)21-15(23)9-10-20-28(26,27)12-7-5-11(6-8-12)22(24)25/h1-8,20H,9-10H2,(H,21,23) |
| InChIKey | CWQPSNZHGVJRBN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|